CAS 2377611-60-2 appears in our catalog under these names: {3,6-Dimethyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl}boronic acid, 95%, (3,6-Dimethyl-(1,2,4)triazolo(4,3-a)pyridin-8-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)boronic acid (CAS 2377611-60-2) is a chemical compound with the molecular formula C8H10BN3O2 and a molecular weight of 191.00 g/mol. IUPAC name: (3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)boronic acid. InChIKey: NUGURNBPXDWUEY-UHFFFAOYSA-N.
| Molecular formula | C8H10BN3O2 |
|---|---|
| Molecular weight | 191.00 g/mol |
| IUPAC name | (3,6-dimethyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)boronic acid |
| InChIKey | NUGURNBPXDWUEY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN2C1=NN=C2C)C)(O)O |
Computed by PubChem (NCBI)