CAS 2346513-09-3 is the registry number for {3-Ethylimidazo[4,5-b]pyridin-6-yl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3-ethylimidazo[4,5-b]pyridin-6-yl)boronic acid (CAS 2346513-09-3) is a chemical compound with the molecular formula C8H10BN3O2 and a molecular weight of 191.00 g/mol. IUPAC name: (3-ethylimidazo[4,5-b]pyridin-6-yl)boronic acid. InChIKey: CASDQECTTBVJBZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BN3O2 |
|---|---|
| Molecular weight | 191.00 g/mol |
| IUPAC name | (3-ethylimidazo[4,5-b]pyridin-6-yl)boronic acid |
| InChIKey | CASDQECTTBVJBZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=C1)N(C=N2)CC)(O)O |
Computed by PubChem (NCBI)