CAS 2255321-08-3 is the registry number for O-(3-Chlorophenyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-3-(3-chlorophenoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2255321-08-3) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2S)-3-(3-chlorophenoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: VCOOSNCILYPUPP-QFIPXVFZSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2S)-3-(3-chlorophenoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | VCOOSNCILYPUPP-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](COC4=CC(=CC=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)