CAS 478183-58-3 appears in our catalog under these names: Fmoc-3-chloro-L-tyrosine, Fmoc-Tyr(3-Cl)-OH, 95%, (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–(3–chloro–4–hydroxyphenyl)propanoic acid, Fmoc-3-chloro-L-tyrosine, >95% (HPLC), Fmoc-Tyr(3-Cl)-OH, 97%, 97%. Offered by: Biosynth, Ambeed, GLPBio, TRC, Chemat. Available pack sizes: 1g, 2g, 5g, 25g, 10g, 250mg, 100mg, 100g.
(2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 478183-58-3) is a chemical compound with the molecular formula C24H20ClNO5 and a molecular weight of 437.9 g/mol. IUPAC name: (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KHDGYTHHDSEGNQ-NRFANRHFSA-N.
| Molecular formula | C24H20ClNO5 |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | (2S)-3-(3-chloro-4-hydroxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KHDGYTHHDSEGNQ-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)O)Cl)C(=O)O |
Computed by PubChem (NCBI)