CAS 225641-82-7 appears in our catalog under these names: (1R,3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclopentyl acetate, 95%, 95%, (1R,3S)-3-((tert-butoxycarbonyl)amino)cyclopentyl acetate, 97%, (1R,3S)-3-((tert-Butoxycarbonyl)amino)cyclopentyl acetate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] acetate (CAS 225641-82-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: [(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] acetate. InChIKey: SJPDVIOPSKNAJB-VHSXEESVSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | [(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] acetate |
| InChIKey | SJPDVIOPSKNAJB-VHSXEESVSA-N |
| SMILES | CC(=O)O[C@@H]1CC[C@@H](C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)