Products 225662-91-9
CAS 225662-91-9 appears in our catalog under these names: Fmoc-D-Ser-OtBu 98%, Fmoc-D-Ser-OtBu, >97%, >97%, tert-Butyl (((9H-fluoren-9-yl)methoxy)carbonyl)-D-serinate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate (CAS 225662-91-9) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 383.4 g/mol. IUPAC name: tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate. InChIKey: ZYOWIDHANLLHNO-LJQANCHMSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoate |
| InChIKey | ZYOWIDHANLLHNO-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)