Products 22567-17-5
CAS 22567-17-5 is the registry number for γ-Gurjunene. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,3aR,4R,7R)-1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene (CAS 22567-17-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,3aR,4R,7R)-1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene. InChIKey: DUYRYUZIBGFLDD-AAVRWANBSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,3aR,4R,7R)-1,4-dimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene |
| InChIKey | DUYRYUZIBGFLDD-AAVRWANBSA-N |
| SMILES | C[C@@H]1CC[C@H](C=C2[C@@H]1CC[C@H]2C)C(=C)C |
Computed by PubChem (NCBI)