Products 2256708-83-3
CAS 2256708-83-3 is the registry number for (3–cyano–4–(oxetan–3–yl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[3-cyano-4-(oxetan-3-yl)phenyl]boronic acid (CAS 2256708-83-3) is a chemical compound with the molecular formula C10H10BNO3 and a molecular weight of 203.00 g/mol. IUPAC name: [3-cyano-4-(oxetan-3-yl)phenyl]boronic acid. InChIKey: QSNCYWVGCDHDTM-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO3 |
|---|---|
| Molecular weight | 203.00 g/mol |
| IUPAC name | [3-cyano-4-(oxetan-3-yl)phenyl]boronic acid |
| InChIKey | QSNCYWVGCDHDTM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2COC2)C#N)(O)O |
Computed by PubChem (NCBI)