Products 874459-89-9
CAS 874459-89-9 appears in our catalog under these names: 4-(propargylaminocarbonyl)phenylboronic acid, 98%, (4-(Prop-2-yn-1-ylcarbamoyl)phenyl)boronic acid 98%, 4-(Propargylaminocarbonyl)phenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
[4-(prop-2-ynylcarbamoyl)phenyl]boronic acid (CAS 874459-89-9) is a chemical compound with the molecular formula C10H10BNO3 and a molecular weight of 203.00 g/mol. IUPAC name: [4-(prop-2-ynylcarbamoyl)phenyl]boronic acid. InChIKey: HKEKSLIZBDCTPR-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO3 |
|---|---|
| Molecular weight | 203.00 g/mol |
| IUPAC name | [4-(prop-2-ynylcarbamoyl)phenyl]boronic acid |
| InChIKey | HKEKSLIZBDCTPR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC#C)(O)O |
Computed by PubChem (NCBI)