Products 2377608-78-9

CAS 2377608-78-9 is the registry number for 1-Methoxyisoquinoline-4-boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(1-methoxyisoquinolin-4-yl)boronic acid (CAS 2377608-78-9) is a chemical compound with the molecular formula C10H10BNO3 and a molecular weight of 203.00 g/mol. IUPAC name: (1-methoxyisoquinolin-4-yl)boronic acid. InChIKey: ZFOQECPSWCRGBI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BNO3
Molecular weight203.00 g/mol
IUPAC name(1-methoxyisoquinolin-4-yl)boronic acid
InChIKeyZFOQECPSWCRGBI-UHFFFAOYSA-N
SMILESB(C1=CN=C(C2=CC=CC=C12)OC)(O)O

Computed by PubChem (NCBI)