Products 2256714-73-3

CAS 2256714-73-3 is the registry number for (S)-2-Amino-2-(4-methylcyclohexyl)acetic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-2-(4-methylcyclohexyl)acetic acid;hydrochloride (CAS 2256714-73-3) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (2S)-2-amino-2-(4-methylcyclohexyl)acetic acid;hydrochloride. InChIKey: NIBZCPLHVAVTCV-CEGZMALOSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name(2S)-2-amino-2-(4-methylcyclohexyl)acetic acid;hydrochloride
InChIKeyNIBZCPLHVAVTCV-CEGZMALOSA-N
SMILESCC1CCC(CC1)[C@@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)