CAS 22583-66-0 is the registry number for 1-(4-(tert-Butyl)phenyl)-2,2-dimethylpropan-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-tert-butylphenyl)-2,2-dimethylpropan-1-one (CAS 22583-66-0) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2,2-dimethylpropan-1-one. InChIKey: ZISXBXYWRHTLEN-UHFFFAOYSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2,2-dimethylpropan-1-one |
| InChIKey | ZISXBXYWRHTLEN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)