Products 2260931-46-0
CAS 2260931-46-0 is the registry number for tert-Butyl 9-oxo-5-oxa-2-azaspiro(3.5)nonane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 9-oxo-5-oxa-2-azaspiro[3.5]nonane-2-carboxylate (CAS 2260931-46-0) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: tert-butyl 9-oxo-5-oxa-2-azaspiro[3.5]nonane-2-carboxylate. InChIKey: ZYMCCMWBSCJAQN-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | tert-butyl 9-oxo-5-oxa-2-azaspiro[3.5]nonane-2-carboxylate |
| InChIKey | ZYMCCMWBSCJAQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(=O)CCCO2 |
Computed by PubChem (NCBI)