Products 2260936-81-8
CAS 2260936-81-8 is the registry number for 3-({[(tert-butoxy)carbonyl]amino}methyl)-3-fluorocyclobutane-1-carboxylic acid, >97%. Offered by: Chemat. Available pack sizes: 100mg.
3-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid (CAS 2260936-81-8) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 3-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid. InChIKey: FEZMFXSHIBGYOB-UHFFFAOYSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 3-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid |
| InChIKey | FEZMFXSHIBGYOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC(C1)C(=O)O)F |
Computed by PubChem (NCBI)