Products 22647-95-6
CAS 22647-95-6 appears in our catalog under these names: 5-(4-bromophenyl)pentanoic acid, 95%, 95%, 5-(4-Bromophenyl)pentanoic acid, 95%, 5-(4-bromophenyl)pentanoic acid 95%, 5–(4–Bromophenyl)pentanoic acid, 5-(4-bromophenyl)pentanoic acid. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 2g, 10g.
5-(4-bromophenyl)pentanoic acid (CAS 22647-95-6) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 5-(4-bromophenyl)pentanoic acid. InChIKey: YWILUDBFIBDCNN-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)pentanoic acid |
| InChIKey | YWILUDBFIBDCNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCCC(=O)O)Br |
Computed by PubChem (NCBI)