CAS 226547-04-2 is the registry number for Urodiolenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R,4aS,6R)-6-(1,2-dihydroxypropan-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CAS 226547-04-2) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: (4R,4aS,6R)-6-(1,2-dihydroxypropan-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one. InChIKey: DJPISZPEZJGKKI-YIIBXEOUSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | (4R,4aS,6R)-6-(1,2-dihydroxypropan-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | DJPISZPEZJGKKI-YIIBXEOUSA-N |
| SMILES | C[C@@H]1CC(=O)C=C2[C@]1(C[C@@H](CC2)C(C)(CO)O)C |
Computed by PubChem (NCBI)