Products 2267291-24-5
CAS 2267291-24-5 is the registry number for 3-(5-(tert-Butoxycarbonyl)-5H-pyrido[4,3-b]indol-7-yl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[5-[(2-methylpropan-2-yl)oxycarbonyl]pyrido[4,3-b]indol-7-yl]propanoic acid (CAS 2267291-24-5) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 3-[5-[(2-methylpropan-2-yl)oxycarbonyl]pyrido[4,3-b]indol-7-yl]propanoic acid. InChIKey: WAYAQKIMECUVFP-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-[5-[(2-methylpropan-2-yl)oxycarbonyl]pyrido[4,3-b]indol-7-yl]propanoic acid |
| InChIKey | WAYAQKIMECUVFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=NC=C2)C3=C1C=C(C=C3)CCC(=O)O |
Computed by PubChem (NCBI)