CAS 260450-76-8 appears in our catalog under these names: Fmoc-l-asparaginol, 95%, Fmoc-L-Asparaginol, 95+%, Fmoc–Asparaginol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate (CAS 260450-76-8) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate. InChIKey: WAVDQIGBMJCGLD-LBPRGKRZSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate |
| InChIKey | WAVDQIGBMJCGLD-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)CO |
Computed by PubChem (NCBI)