Products 930699-88-0

CAS 930699-88-0 is the registry number for 1-((4-Carbamoylphenyl)amino)-1-oxopropan-2-yl 3-phenylpropanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-phenylpropanoate (CAS 930699-88-0) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: [1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-phenylpropanoate. InChIKey: IEHOCDBJODDZGL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O4
Molecular weight340.4 g/mol
IUPAC name[1-(4-carbamoylanilino)-1-oxopropan-2-yl] 3-phenylpropanoate
InChIKeyIEHOCDBJODDZGL-UHFFFAOYSA-N
SMILESCC(C(=O)NC1=CC=C(C=C1)C(=O)N)OC(=O)CCC2=CC=CC=C2

Computed by PubChem (NCBI)