CAS 2268818-01-3 appears in our catalog under these names: Diethyl 4-aminopyridine-2,6-dicarboxylate hydrochloride, 95%, Diethyl 4-aminopyridine-2,6-dicarboxylate hydrochloride, 98%, Diethyl 4-Aminopyridine-2,6-dicarboxylate Hydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 5g, 250mg, 1g, on request.
Diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride (CAS 2268818-01-3) is a chemical compound with the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. IUPAC name: diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride. InChIKey: JNILXLRUCNZHOZ-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | diethyl 4-aminopyridine-2,6-dicarboxylate;hydrochloride |
| InChIKey | JNILXLRUCNZHOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=N1)C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)