CAS 2375247-61-1 is the registry number for Methyl (2r)-2-(2-aminoacetamido)-2-(4-hydroxyphenyl)acetate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate;hydrochloride (CAS 2375247-61-1) is a chemical compound with the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. IUPAC name: methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate;hydrochloride. InChIKey: POGPKDZWSINDOE-HNCPQSOCSA-N.
| Molecular formula | C11H15ClN2O4 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | POGPKDZWSINDOE-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)O)NC(=O)CN.Cl |
Computed by PubChem (NCBI)