CAS 2830580-07-7 is the registry number for Ethyl 2-(5-chloro-4-hydroxy-3-isopropyl-6-oxopyridazin-1(6H)-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(5-chloro-4-hydroxy-6-oxo-3-propan-2-ylpyridazin-1-yl)acetate (CAS 2830580-07-7) is a chemical compound with the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. IUPAC name: ethyl 2-(5-chloro-4-hydroxy-6-oxo-3-propan-2-ylpyridazin-1-yl)acetate. InChIKey: LELUVCHEAJJOOX-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O4 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | ethyl 2-(5-chloro-4-hydroxy-6-oxo-3-propan-2-ylpyridazin-1-yl)acetate |
| InChIKey | LELUVCHEAJJOOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C(=C(C(=N1)C(C)C)O)Cl |
Computed by PubChem (NCBI)