Products 226904-40-1
CAS 226904-40-1 is the registry number for 4-Hydroxy-1,10-secocadin-5-ene-1,10-dione. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
4-hydroxy-4-methyl-2-[(3R)-2-methyl-6-oxoheptan-3-yl]cyclohex-2-en-1-one (CAS 226904-40-1) is a chemical compound with the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. IUPAC name: 4-hydroxy-4-methyl-2-[(3R)-2-methyl-6-oxoheptan-3-yl]cyclohex-2-en-1-one. InChIKey: ZOEYQETWCHEROV-KEKZHRQWSA-N.
| Molecular formula | C15H24O3 |
|---|---|
| Molecular weight | 252.35 g/mol |
| IUPAC name | 4-hydroxy-4-methyl-2-[(3R)-2-methyl-6-oxoheptan-3-yl]cyclohex-2-en-1-one |
| InChIKey | ZOEYQETWCHEROV-KEKZHRQWSA-N |
| SMILES | CC(C)[C@@H](CCC(=O)C)C1=CC(CCC1=O)(C)O |
Computed by PubChem (NCBI)