Products 2270905-15-0

CAS 2270905-15-0 is the registry number for [4-(2-Fluoro-4-methoxy-phenyl)-piperidin-1-yl]-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[4-(2-fluoro-4-methoxyphenyl)piperidin-1-yl]acetic acid (CAS 2270905-15-0) is a chemical compound with the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. IUPAC name: 2-[4-(2-fluoro-4-methoxyphenyl)piperidin-1-yl]acetic acid. InChIKey: CEUZHFDFPPJEOK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18FNO3
Molecular weight267.30 g/mol
IUPAC name2-[4-(2-fluoro-4-methoxyphenyl)piperidin-1-yl]acetic acid
InChIKeyCEUZHFDFPPJEOK-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2CCN(CC2)CC(=O)O)F

Computed by PubChem (NCBI)