CAS 2711860-18-1 is the registry number for Benzyl ((1S,3R,4R)-3-fluoro-4-hydroxycyclohexyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1S,3R,4R)-3-fluoro-4-hydroxycyclohexyl]carbamate (CAS 2711860-18-1) is a chemical compound with the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. IUPAC name: benzyl N-[(1S,3R,4R)-3-fluoro-4-hydroxycyclohexyl]carbamate. InChIKey: MFPNGYKRUBBZQW-YNEHKIRRSA-N.
| Molecular formula | C14H18FNO3 |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | benzyl N-[(1S,3R,4R)-3-fluoro-4-hydroxycyclohexyl]carbamate |
| InChIKey | MFPNGYKRUBBZQW-YNEHKIRRSA-N |
| SMILES | C1C[C@H]([C@@H](C[C@H]1NC(=O)OCC2=CC=CC=C2)F)O |
Computed by PubChem (NCBI)