CAS 2757409-65-5 is the registry number for tert-Butyl 8-fluoro-1-hydroxy-3,4-dihydroisoquinoline-2(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-fluoro-1-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 2757409-65-5) is a chemical compound with the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. IUPAC name: tert-butyl 8-fluoro-1-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: KSFQTFCVILVCIE-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO3 |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | tert-butyl 8-fluoro-1-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | KSFQTFCVILVCIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1O)C(=CC=C2)F |
Computed by PubChem (NCBI)