Products 2270911-42-5
CAS 2270911-42-5 is the registry number for 5-Bromo-4-fluoro-2,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-4-fluoro-N,2-dimethylbenzamide (CAS 2270911-42-5) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 5-bromo-4-fluoro-N,2-dimethylbenzamide. InChIKey: SRAUXVIOEADIGA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 5-bromo-4-fluoro-N,2-dimethylbenzamide |
| InChIKey | SRAUXVIOEADIGA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)NC)Br)F |
Computed by PubChem (NCBI)