CAS 2270911-52-7 is the registry number for 4-Fluoro-5-hydroxy-2,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-fluoro-5-hydroxy-N,2-dimethylbenzamide (CAS 2270911-52-7) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 4-fluoro-5-hydroxy-N,2-dimethylbenzamide. InChIKey: XPNKGVMITJQYOE-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 4-fluoro-5-hydroxy-N,2-dimethylbenzamide |
| InChIKey | XPNKGVMITJQYOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)NC)O)F |
Computed by PubChem (NCBI)