CAS 2270911-56-1 is the registry number for 4'-Bromo-3'-methyl-biphenyl-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-bromo-3-methylphenyl)benzoic acid (CAS 2270911-56-1) is a chemical compound with the molecular formula C14H11BrO2 and a molecular weight of 291.14 g/mol. IUPAC name: 4-(4-bromo-3-methylphenyl)benzoic acid. InChIKey: CDBJCOAGAKSTJM-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO2 |
|---|---|
| Molecular weight | 291.14 g/mol |
| IUPAC name | 4-(4-bromo-3-methylphenyl)benzoic acid |
| InChIKey | CDBJCOAGAKSTJM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)