Products 2270911-70-9

CAS 2270911-70-9 is the registry number for 4-[2-(4-Carboxy-phenyl)-ethyl]-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]benzoic acid (CAS 2270911-70-9) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 4-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]benzoic acid. InChIKey: VGJVRRXFUFZDPC-UHFFFAOYSA-N.

Identity
Molecular formulaC22H25NO4
Molecular weight367.4 g/mol
IUPAC name4-[2-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]benzoic acid
InChIKeyVGJVRRXFUFZDPC-UHFFFAOYSA-N
SMILESC1CN(CCC1CCC2=CC=C(C=C2)C(=O)O)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)