Products 2270937-70-5
CAS 2270937-70-5 is the registry number for 2',6'-Dimethyl-[1,1'-biphenyl]-3,4',5-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-carboxy-2,6-dimethylphenyl)benzene-1,3-dicarboxylic acid (CAS 2270937-70-5) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 5-(4-carboxy-2,6-dimethylphenyl)benzene-1,3-dicarboxylic acid. InChIKey: KJDOWYXTORFWPD-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 5-(4-carboxy-2,6-dimethylphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | KJDOWYXTORFWPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C)C(=O)O |
Computed by PubChem (NCBI)