CAS 2412748-02-6 is the registry number for Benzo[d][1,3]dioxol-5-yl (E)-3-(4-hydroxy-3-methoxyphenyl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-benzodioxol-5-yl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 2412748-02-6) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 1,3-benzodioxol-5-yl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: RMDCWJIJKYQBTC-XVNBXDOJSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | RMDCWJIJKYQBTC-XVNBXDOJSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC2=CC3=C(C=C2)OCO3)O |
Computed by PubChem (NCBI)