CAS 93322-61-3 appears in our catalog under these names: 3,7-Dihydroxy-3',4'-dimethoxyflavone, 3,7-Dihydroxy-3',4'-dimethoxyflavone, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 100mg, 500mg.
2-(3,4-dimethoxyphenyl)-3,7-dihydroxychromen-4-one (CAS 93322-61-3) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-3,7-dihydroxychromen-4-one. InChIKey: LTSJJOKAWSCMBC-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-3,7-dihydroxychromen-4-one |
| InChIKey | LTSJJOKAWSCMBC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)OC |
Computed by PubChem (NCBI)