CAS 2271186-72-0 is the registry number for 1-Methyl-1H-indole-3-carbaldehyde-d3. Offered by: TRC. Available pack sizes: 100mg.
1-(trideuteriomethyl)indole-3-carbaldehyde (CAS 2271186-72-0) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 162.20 g/mol. IUPAC name: 1-(trideuteriomethyl)indole-3-carbaldehyde. InChIKey: KXYBYRKRRGSZCX-FIBGUPNXSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 162.20 g/mol |
| IUPAC name | 1-(trideuteriomethyl)indole-3-carbaldehyde |
| InChIKey | KXYBYRKRRGSZCX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(C2=CC=CC=C21)C=O |
Computed by PubChem (NCBI)