CAS 2271443-03-7 is the registry number for 2,6-Dimethyl-4'-methoxy-[1,1'-biphenyl]-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-(4-methoxyphenyl)-3,5-dimethylbenzaldehyde (CAS 2271443-03-7) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 4-(4-methoxyphenyl)-3,5-dimethylbenzaldehyde. InChIKey: KYOMOIAXRGWCCB-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-3,5-dimethylbenzaldehyde |
| InChIKey | KYOMOIAXRGWCCB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=CC=C(C=C2)OC)C)C=O |
Computed by PubChem (NCBI)