CAS 2272861-72-8 appears in our catalog under these names: Boc-DL-3,3-DicPr-Ala-OH 98%, 2-((Tert-butoxycarbonyl)amino)-3,3-dicyclopropylpropanoic acid, 98%, 98%, 2-((Tert-butoxycarbonyl)amino)-3,3-dicyclopropylpropanoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2272861-72-8) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VRJSPHBNIYAYAY-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VRJSPHBNIYAYAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(C1CC1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)