CAS 2548967-22-0 appears in our catalog under these names: Boc-3,3-DicPr-Ala-OH 98%, (S)-2-((tert-Butoxycarbonyl)amino)-3,3-dicyclopropylpropanoic acid, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-3,3-dicyclopropylpropanoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg, 500mg.
(2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2548967-22-0) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VRJSPHBNIYAYAY-NSHDSACASA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | (2S)-3,3-dicyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VRJSPHBNIYAYAY-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(C1CC1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)