CAS 2272917-12-9 appears in our catalog under these names: NDT-19795, NDT-19795, 99.16%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 25 mg, 50 mg, 10 mg, 100 mg, 5 mg.
(2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid (CAS 2272917-12-9) is a chemical compound with the molecular formula C20H21N3O4 and a molecular weight of 367.4 g/mol. IUPAC name: (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid. InChIKey: OYXWZQHGHRELLY-MRXNPFEDSA-N.
| Molecular formula | C20H21N3O4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid |
| InChIKey | OYXWZQHGHRELLY-MRXNPFEDSA-N |
| SMILES | C1CC2=CC3=C(CCC3)C(=C2C1)NC(=O)O[C@H](CC4=NC=CC=N4)C(=O)O |
Computed by PubChem (NCBI)