Products 2975168-22-8
CAS 2975168-22-8 is the registry number for Antitumor agent-138. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-amino-5-(4-methylphenyl)pyrazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone (CAS 2975168-22-8) is a chemical compound with the molecular formula C20H21N3O4 and a molecular weight of 367.4 g/mol. IUPAC name: [3-amino-5-(4-methylphenyl)pyrazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone. InChIKey: ZQKUQZRCKHGGMF-UHFFFAOYSA-N.
| Molecular formula | C20H21N3O4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | [3-amino-5-(4-methylphenyl)pyrazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | ZQKUQZRCKHGGMF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C(=O)C3=CC(=C(C(=C3)OC)OC)OC)N |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-138, orb2566975