Products 2272918-42-8

CAS 2272918-42-8 is the registry number for (rac)-NDT-19795, 99.34%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid (CAS 2272918-42-8) is a chemical compound with the molecular formula C20H21N3O4 and a molecular weight of 367.4 g/mol. IUPAC name: 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid. InChIKey: OYXWZQHGHRELLY-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21N3O4
Molecular weight367.4 g/mol
IUPAC name2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoic acid
InChIKeyOYXWZQHGHRELLY-UHFFFAOYSA-N
SMILESC1CC2=CC3=C(CCC3)C(=C2C1)NC(=O)OC(CC4=NC=CC=N4)C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3181839