CAS 2275604-60-7 appears in our catalog under these names: 1-Methyl-4-(1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)-1H-pyrazole, 97%, 1-(1-Methyl-4-pyrazolyl)vinylboronic Acid Pinacol Ester, ≥95%, ≥95%, 1-(1-METHYL-4-PYRAZOLYL)VINYLBORONIC ACID PINACOL ESTER, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
1-methyl-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole (CAS 2275604-60-7) is a chemical compound with the molecular formula C12H19BN2O2 and a molecular weight of 234.10 g/mol. IUPAC name: 1-methyl-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole. InChIKey: LYXSOUAMCIVRKU-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O2 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 1-methyl-4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyrazole |
| InChIKey | LYXSOUAMCIVRKU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CN(N=C2)C |
Computed by PubChem (NCBI)