CAS 2278294-63-4 is the registry number for tert-Butyl 6-bromo-1,8-naphthyridine-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromo-2H-1,8-naphthyridine-1-carboxylate (CAS 2278294-63-4) is a chemical compound with the molecular formula C13H15BrN2O2 and a molecular weight of 311.17 g/mol. IUPAC name: tert-butyl 6-bromo-2H-1,8-naphthyridine-1-carboxylate. InChIKey: QULZMRLUEWUQBO-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O2 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | tert-butyl 6-bromo-2H-1,8-naphthyridine-1-carboxylate |
| InChIKey | QULZMRLUEWUQBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CC2=C1N=CC(=C2)Br |
Computed by PubChem (NCBI)