Products 2280980-72-3
CAS 2280980-72-3 is the registry number for (4-Prop-2-ynoxyphenyl)boronic acid, pinacol ester. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4,4,5,5-tetramethyl-2-(4-prop-2-ynoxyphenyl)-1,3,2-dioxaborolane (CAS 2280980-72-3) is a chemical compound with the molecular formula C15H19BO3 and a molecular weight of 258.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-prop-2-ynoxyphenyl)-1,3,2-dioxaborolane. InChIKey: LOZNHJKYASQTFL-UHFFFAOYSA-N.
| Molecular formula | C15H19BO3 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-prop-2-ynoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | LOZNHJKYASQTFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC#C |
Computed by PubChem (NCBI)