Products 1132943-82-8
CAS 1132943-82-8 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(3-methylbenzofuran-6-yl)-1,3,2-dioxaborolane, 97%, 97%, 4,4,5,5-Tetramethyl-2-(3-methylbenzofuran-6-yl)-1,3,2-dioxaborolane, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(3-methyl-1-benzofuran-6-yl)-1,3,2-dioxaborolane (CAS 1132943-82-8) is a chemical compound with the molecular formula C15H19BO3 and a molecular weight of 258.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methyl-1-benzofuran-6-yl)-1,3,2-dioxaborolane. InChIKey: HSYZAQAPIIELCZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BO3 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methyl-1-benzofuran-6-yl)-1,3,2-dioxaborolane |
| InChIKey | HSYZAQAPIIELCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=CO3)C |
Computed by PubChem (NCBI)