CAS 872356-95-1 appears in our catalog under these names: 2-((4-Methoxyphenyl)ethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 2-((4-Methoxyphenyl)ethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Hoffman Fine Chemicals, Chemat Brand. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, on request.
2-[2-(4-methoxyphenyl)ethynyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 872356-95-1) is a chemical compound with the molecular formula C15H19BO3 and a molecular weight of 258.12 g/mol. IUPAC name: 2-[2-(4-methoxyphenyl)ethynyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NGTXWTZHUNALBA-UHFFFAOYSA-N.
| Molecular formula | C15H19BO3 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 2-[2-(4-methoxyphenyl)ethynyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NGTXWTZHUNALBA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)