CAS 2281857-00-7 is the registry number for 1,1-Dimethylethyl (3R,4S)-3-cyano-4-phenyl-1-pyrrolidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3R,4S)-3-cyano-4-phenylpyrrolidine-1-carboxylate (CAS 2281857-00-7) is a chemical compound with the molecular formula C16H20N2O2 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl (3R,4S)-3-cyano-4-phenylpyrrolidine-1-carboxylate. InChIKey: GGOYCDNRCOQXSX-UONOGXRCSA-N.
| Molecular formula | C16H20N2O2 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-cyano-4-phenylpyrrolidine-1-carboxylate |
| InChIKey | GGOYCDNRCOQXSX-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)