Products 2282-84-0
CAS 2282-84-0 appears in our catalog under these names: Methyl 2,4,6-trimethylbenzoate, 98%, Methyl 2，4，6–trimethylbenzoate, Methyl 2,4,6-trimethylbenzoate, 97%, 97%, 2,4,6-Trimethylbenzoic acid methyl ester, Methyl 2,4,6-trimethylbenzoate, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, HPC Standards, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg, 1x25mg.
Methyl 2,4,6-trimethylbenzoate (CAS 2282-84-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: methyl 2,4,6-trimethylbenzoate. InChIKey: PXLABDTXHJPRRH-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | methyl 2,4,6-trimethylbenzoate |
| InChIKey | PXLABDTXHJPRRH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)OC)C |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-trimethylbenzoic acid methyl ester, Methyl 2,4,6-trimethylbenzoate, Methyl mesitoate, Methyl .beta.-isodurilate, Benzoic acid, 2,4,6-trimethyl-, methyl ester, 2,4,6-trimethyl-benzoic acid methyl ester, Methyl2,4,6-trimethylbenzoate, PXLABDTXHJPRRH-UHFFFAOYSA-N, 2,4,6-trimethylbenzoic acid, methyl ester