Products 22841-86-7
CAS 22841-86-7 is the registry number for 3,8-Dichloro-[1,2,4]triazolo[4,3-a]pyridine, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
3,8-dichloro-[1,2,4]triazolo[4,3-a]pyridine (CAS 22841-86-7) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3,8-dichloro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: ZSKDUIISOKVWTF-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,8-dichloro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | ZSKDUIISOKVWTF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2Cl)C(=C1)Cl |
Computed by PubChem (NCBI)