CAS 228413-61-4 is the registry number for 2-Amino-4-phenylthiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-amino-4-phenyl-1,3-thiazole-5-carboxylic acid (CAS 228413-61-4) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 2-amino-4-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: VNKAOZFTIGAIPR-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-amino-4-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | VNKAOZFTIGAIPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)