CAS 2285995-67-5 is the registry number for 4-Bromo-1-cyclobutyl-1H-pyrazolo[3,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1-cyclobutylpyrazolo[3,4-b]pyridine (CAS 2285995-67-5) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 4-bromo-1-cyclobutylpyrazolo[3,4-b]pyridine. InChIKey: AUBCYVSBRHLLGO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 4-bromo-1-cyclobutylpyrazolo[3,4-b]pyridine |
| InChIKey | AUBCYVSBRHLLGO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)N2C3=NC=CC(=C3C=N2)Br |
Computed by PubChem (NCBI)